CAS 4251-08-5 appears in our catalog under these names: N–(3–chlorophenyl)–N–phenyl–Thiourea, 1-(3-chlorophenyl)-3-phenylthiourea, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
1-(3-chlorophenyl)-3-phenylthiourea (CAS 4251-08-5) is a chemical compound with the molecular formula C13H11ClN2S and a molecular weight of 262.76 g/mol. IUPAC name: 1-(3-chlorophenyl)-3-phenylthiourea. InChIKey: YRBVLVKDMVTDDO-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2S |
|---|---|
| Molecular weight | 262.76 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-3-phenylthiourea |
| InChIKey | YRBVLVKDMVTDDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=S)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)