CAS 42529-06-6 is the registry number for Quercetagetinidin chloride. Offered by: GLPBio. Available pack sizes: 1mg.
6-hydroxycyanidin is an anthocyanidin cation that is cyanidin substituted by a hydroxy group at position 6. It is functionally related to a cyanidin cation.
Source: ChEBI
| Molecular formula | C15H11O7+ |
|---|---|
| Molecular weight | 303.24 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)chromenylium-3,5,6,7-tetrol |
| InChIKey | PWDAKBACEAGRSH-UHFFFAOYSA-O |
| SMILES | C1=CC(=C(C=C1C2=C(C=C3C(=[O+]2)C=C(C(=C3O)O)O)O)O)O |
Computed by PubChem (NCBI)