CAS 42538-64-7 appears in our catalog under these names: Boc-Gly-O Cs salt, 98%, Cesium 2-((tert-butoxycarbonyl)amino)acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100g, 5g, 25g.
Cesium 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CAS 42538-64-7) is a chemical compound with the molecular formula C7H12CsNO4 and a molecular weight of 307.08 g/mol. IUPAC name: cesium 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate. InChIKey: RICFWCXESOWLSS-UHFFFAOYSA-M.
| Molecular formula | C7H12CsNO4 |
|---|---|
| Molecular weight | 307.08 g/mol |
| IUPAC name | cesium 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| InChIKey | RICFWCXESOWLSS-UHFFFAOYSA-M |
| SMILES | CC(C)(C)OC(=O)NCC(=O)[O-].[Cs+] |
Computed by PubChem (NCBI)