CAS 42538-67-0 is the registry number for BOc-l-leucine-o cesium salt, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Cesium (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 42538-67-0) is a chemical compound with the molecular formula C11H20CsNO4 and a molecular weight of 363.19 g/mol. IUPAC name: cesium (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: WJBILHWLBVFLOA-QRPNPIFTSA-M.
| Molecular formula | C11H20CsNO4 |
|---|---|
| Molecular weight | 363.19 g/mol |
| IUPAC name | cesium (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| InChIKey | WJBILHWLBVFLOA-QRPNPIFTSA-M |
| SMILES | CC(C)C[C@@H](C(=O)[O-])NC(=O)OC(C)(C)C.[Cs+] |
Computed by PubChem (NCBI)