CAS 425618-72-0 is the registry number for Methyl n-(3-chloro-4-methoxyphenyl)-n-(methylsulfonyl)glycinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetate (CAS 425618-72-0) is a chemical compound with the molecular formula C11H14ClNO5S and a molecular weight of 307.75 g/mol. IUPAC name: methyl 2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetate. InChIKey: IAGLIPPTIPJZHK-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO5S |
|---|---|
| Molecular weight | 307.75 g/mol |
| IUPAC name | methyl 2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetate |
| InChIKey | IAGLIPPTIPJZHK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N(CC(=O)OC)S(=O)(=O)C)Cl |
Computed by PubChem (NCBI)