Products 425653-38-9

CAS 425653-38-9 is the registry number for WAY-320774, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-[[5-(2-phenylethyl)-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]acetic acid (CAS 425653-38-9) is a chemical compound with the molecular formula C19H16N4O2S and a molecular weight of 364.4 g/mol. IUPAC name: 2-[[5-(2-phenylethyl)-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]acetic acid. InChIKey: JLJFTUVZXOAPAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16N4O2S
Molecular weight364.4 g/mol
IUPAC name2-[[5-(2-phenylethyl)-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]acetic acid
InChIKeyJLJFTUVZXOAPAZ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCN2C3=CC=CC=C3C4=C2N=C(N=N4)SCC(=O)O

Computed by PubChem (NCBI)