CAS 42596-10-1 is the registry number for 5,7-Dichloro-2-(3,5-dimethyl-1h-pyrazol-1-yl)quinolin-8-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-N-[(E)-(2,6-dichlorophenyl)methylideneamino]benzamide (CAS 42596-10-1) is a chemical compound with the molecular formula C14H11Cl2N3O and a molecular weight of 308.2 g/mol. IUPAC name: 2-amino-N-[(E)-(2,6-dichlorophenyl)methylideneamino]benzamide. InChIKey: OYZSXJIMBMLZON-QGMBQPNBSA-N.
| Molecular formula | C14H11Cl2N3O |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | 2-amino-N-[(E)-(2,6-dichlorophenyl)methylideneamino]benzamide |
| InChIKey | OYZSXJIMBMLZON-QGMBQPNBSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N/N=C/C2=C(C=CC=C2Cl)Cl)N |
Computed by PubChem (NCBI)