CAS 426-79-9 appears in our catalog under these names: Tetraphenylphosphonium Tetrafluoroborate, Tetraphenylphosphonium tetrafluoroborate 98%, Tetraphenylphosphonium tetrafluoroborate, 98%, 98%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 50g, 250g, 500g, 1g, 5g, 25g.
Tetraphenylphosphanium tetrafluoroborate (CAS 426-79-9) is a chemical compound with the molecular formula C24H20BF4P and a molecular weight of 426.2 g/mol. IUPAC name: tetraphenylphosphanium tetrafluoroborate. InChIKey: MAJBFAYVSDYMQG-UHFFFAOYSA-N.
| Molecular formula | C24H20BF4P |
|---|---|
| Molecular weight | 426.2 g/mol |
| IUPAC name | tetraphenylphosphanium tetrafluoroborate |
| InChIKey | MAJBFAYVSDYMQG-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)