CAS 42601-58-1 is the registry number for 3,3',5,5'-Tetrakis(bromomethyl)-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-[3,5-bis(bromomethyl)phenyl]-3,5-bis(bromomethyl)benzene (CAS 42601-58-1) is a chemical compound with the molecular formula C16H14Br4 and a molecular weight of 525.9 g/mol. IUPAC name: 1-[3,5-bis(bromomethyl)phenyl]-3,5-bis(bromomethyl)benzene. InChIKey: BSBURJJDZLTVOO-UHFFFAOYSA-N.
| Molecular formula | C16H14Br4 |
|---|---|
| Molecular weight | 525.9 g/mol |
| IUPAC name | 1-[3,5-bis(bromomethyl)phenyl]-3,5-bis(bromomethyl)benzene |
| InChIKey | BSBURJJDZLTVOO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1CBr)C2=CC(=CC(=C2)CBr)CBr)CBr |
Computed by PubChem (NCBI)