Products 426231-89-2

CAS 426231-89-2 is the registry number for 4-((2-Bromo-4-formyl-6-methoxyphenoxy)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[(2-bromo-4-formyl-6-methoxyphenoxy)methyl]benzoic acid (CAS 426231-89-2) is a chemical compound with the molecular formula C16H13BrO5 and a molecular weight of 365.17 g/mol. IUPAC name: 4-[(2-bromo-4-formyl-6-methoxyphenoxy)methyl]benzoic acid. InChIKey: RIPLRJURJWYSDY-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13BrO5
Molecular weight365.17 g/mol
IUPAC name4-[(2-bromo-4-formyl-6-methoxyphenoxy)methyl]benzoic acid
InChIKeyRIPLRJURJWYSDY-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)C=O)Br)OCC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)