CAS 426268-06-6 appears in our catalog under these names: RO-4582640 (4-(8-Benzo(1,2,5)oxadiazol-5-yl-(1,7)naphthyridin-6-yl)-benzoic acid), NVP-ABE171. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
4-[8-(2,1,3-benzoxadiazol-5-yl)-1,7-naphthyridin-6-yl]benzoic acid (CAS 426268-06-6) is a chemical compound with the molecular formula C21H12N4O3 and a molecular weight of 368.3 g/mol. IUPAC name: 4-[8-(2,1,3-benzoxadiazol-5-yl)-1,7-naphthyridin-6-yl]benzoic acid. InChIKey: IALXIRPKVRUJQO-UHFFFAOYSA-N.
| Molecular formula | C21H12N4O3 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | 4-[8-(2,1,3-benzoxadiazol-5-yl)-1,7-naphthyridin-6-yl]benzoic acid |
| InChIKey | IALXIRPKVRUJQO-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=NC(=C2N=C1)C3=CC4=NON=C4C=C3)C5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)