CAS 4267-80-5 appears in our catalog under these names: 2,3-Thioepoxy Madol (1.0mg/ml in Acetonitrile), 2,3-Thioepoxy Madol, >95% (HPLC), Hemapolin. Offered by: TRC, GLPBio. Available pack sizes: 1x1ml, 10mg, 1mg, 2,5mg, 1g, 250mg, 50mg, 5mg.
(1S,2S,4R,6S,8S,11R,12S,15S,16S)-2,15,16-trimethyl-5-thiapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol (CAS 4267-80-5) is a chemical compound with the molecular formula C20H32OS and a molecular weight of 320.5 g/mol. IUPAC name: (1S,2S,4R,6S,8S,11R,12S,15S,16S)-2,15,16-trimethyl-5-thiapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol. InChIKey: UPLPHRJJTCUQAY-WIRWPRASSA-N.
| Molecular formula | C20H32OS |
|---|---|
| Molecular weight | 320.5 g/mol |
| IUPAC name | (1S,2S,4R,6S,8S,11R,12S,15S,16S)-2,15,16-trimethyl-5-thiapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol |
| InChIKey | UPLPHRJJTCUQAY-WIRWPRASSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@]3(C[C@@H]5[C@H](C4)S5)C |
Computed by PubChem (NCBI)