CAS 426844-22-6 is the registry number for Pyrrolidine Related Compound 16. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,4S)-2-carbamoyl-4-fluoropyrrolidine-1-carboxylate (CAS 426844-22-6) is a chemical compound with the molecular formula C10H17FN2O3 and a molecular weight of 232.25 g/mol. IUPAC name: tert-butyl (2S,4S)-2-carbamoyl-4-fluoropyrrolidine-1-carboxylate. InChIKey: SQGNCVVKJIZGLC-BQBZGAKWSA-N.
| Molecular formula | C10H17FN2O3 |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-carbamoyl-4-fluoropyrrolidine-1-carboxylate |
| InChIKey | SQGNCVVKJIZGLC-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)N)F |
Computed by PubChem (NCBI)