CAS 427-36-1 is the registry number for Fluorotriphenylmethane. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg, 10000mg.
[fluoro(diphenyl)methyl]benzene (CAS 427-36-1) is a chemical compound with the molecular formula C19H15F and a molecular weight of 262.3 g/mol. IUPAC name: [fluoro(diphenyl)methyl]benzene. InChIKey: SOOHMJJPRAGGSQ-UHFFFAOYSA-N.
| Molecular formula | C19H15F |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | [fluoro(diphenyl)methyl]benzene |
| InChIKey | SOOHMJJPRAGGSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)F |
Computed by PubChem (NCBI)