CAS 4272-74-6 appears in our catalog under these names: (3S)-1-Chloro-3-tosylamido-7-amino-2-heptanone hydrochloride, 95%, N-alpha-Tosyl-L-lysine chloromethyl ketone hydrochloride/ 97.44% (existing batch purity), Tosyllysine Chloromethyl Ketone (hydrochloride), N-alpha-Tosyl-L-lysine chloromethyl ketone HCl, (3S)-1-Chloro-3-tosylamido-7-amino-2-heptanone hydrochloride, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 1g, 250mg, 5mg, 10mg, 25mg, 100mg, 50mg, 500mg.
N-[(3S)-7-amino-1-chloro-2-oxoheptan-3-yl]-4-methylbenzenesulfonamide;hydrochloride (CAS 4272-74-6) is a chemical compound with the molecular formula C14H22Cl2N2O3S and a molecular weight of 369.3 g/mol. IUPAC name: N-[(3S)-7-amino-1-chloro-2-oxoheptan-3-yl]-4-methylbenzenesulfonamide;hydrochloride. InChIKey: YFCUZWYIPBUQBD-ZOWNYOTGSA-N.
| Molecular formula | C14H22Cl2N2O3S |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | N-[(3S)-7-amino-1-chloro-2-oxoheptan-3-yl]-4-methylbenzenesulfonamide;hydrochloride |
| InChIKey | YFCUZWYIPBUQBD-ZOWNYOTGSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CCCCN)C(=O)CCl.Cl |
Computed by PubChem (NCBI)