CAS 427878-41-9 appears in our catalog under these names: Ethyl 4-chloro-5-methylpyrrolo[1,2-f][1,2,4]triazine-6-carboxylate, 95%, Ethyl 4-chloro-5-methylpyrrolo(2,1-f)(1,2,4)triazine-6-carboxylate, 97%, ethyl 4-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg, 500mg.
Ethyl 4-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (CAS 427878-41-9) is a chemical compound with the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. IUPAC name: ethyl 4-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate. InChIKey: ZIMADRWWQDVUQL-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O2 |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | ethyl 4-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| InChIKey | ZIMADRWWQDVUQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C(=C1C)C(=NC=N2)Cl |
Computed by PubChem (NCBI)