CAS 428-76-2 appears in our catalog under these names: Bis((trifluoromethyl)sulfonyl)methane 95%, Bis[(trifluoromethyl)sulfonyl]methane, 95%, 95%, BIS(TRIFLUOROMETHANESULFONYL)METHANE, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
Trifluoro(trifluoromethylsulfonylmethylsulfonyl)methane (CAS 428-76-2) is a chemical compound with the molecular formula C3H2F6O4S2 and a molecular weight of 280.2 g/mol. IUPAC name: trifluoro(trifluoromethylsulfonylmethylsulfonyl)methane. InChIKey: QBOFWVRRMVGXIG-UHFFFAOYSA-N.
| Molecular formula | C3H2F6O4S2 |
|---|---|
| Molecular weight | 280.2 g/mol |
| IUPAC name | trifluoro(trifluoromethylsulfonylmethylsulfonyl)methane |
| InChIKey | QBOFWVRRMVGXIG-UHFFFAOYSA-N |
| SMILES | C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)