CAS 42808-07-1 is the registry number for Dansyl-DL-aspartic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]butanedioic acid (CAS 42808-07-1) is a chemical compound with the molecular formula C16H18N2O6S and a molecular weight of 366.4 g/mol. IUPAC name: 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]butanedioic acid. InChIKey: DHOZTIJMCYMTMJ-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O6S |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]butanedioic acid |
| InChIKey | DHOZTIJMCYMTMJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)NC(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)