CAS 42837-44-5 appears in our catalog under these names: 4,4''–Bis(bromomethyl)–5'–(4–(bromomethyl)phenyl)–1,1':3',1''–terphenyl, 1,1':3',1''-Terphenyl, 4,4''-bis(bromomethyl)-5'-[4-(bromomethyl)phenyl]-, 97%, 97%, 4,4''-Bis(bromomethyl)-5'-(4-(bromomethyl)phenyl)-1,1':3',1''-terphenyl, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg.
1,3,5-tris[4-(bromomethyl)phenyl]benzene (CAS 42837-44-5) is a chemical compound with the molecular formula C27H21Br3 and a molecular weight of 585.2 g/mol. IUPAC name: 1,3,5-tris[4-(bromomethyl)phenyl]benzene. InChIKey: OMSHYLJZYDPPHE-UHFFFAOYSA-N.
| Molecular formula | C27H21Br3 |
|---|---|
| Molecular weight | 585.2 g/mol |
| IUPAC name | 1,3,5-tris[4-(bromomethyl)phenyl]benzene |
| InChIKey | OMSHYLJZYDPPHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)C2=CC(=CC(=C2)C3=CC=C(C=C3)CBr)C4=CC=C(C=C4)CBr |
Computed by PubChem (NCBI)