Products 428466-43-7

CAS 428466-43-7 is the registry number for 3-((2-Chloro-4-formyl-6-methoxyphenoxy)methyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(2-chloro-4-formyl-6-methoxyphenoxy)methyl]benzoic acid (CAS 428466-43-7) is a chemical compound with the molecular formula C16H13ClO5 and a molecular weight of 320.72 g/mol. IUPAC name: 3-[(2-chloro-4-formyl-6-methoxyphenoxy)methyl]benzoic acid. InChIKey: YJKFUNIQCGBKDY-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13ClO5
Molecular weight320.72 g/mol
IUPAC name3-[(2-chloro-4-formyl-6-methoxyphenoxy)methyl]benzoic acid
InChIKeyYJKFUNIQCGBKDY-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)C=O)Cl)OCC2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)