Products 428498-47-9

CAS 428498-47-9 is the registry number for 4-((4-Formyl-2-iodo-6-methoxyphenoxy)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[(4-formyl-2-iodo-6-methoxyphenoxy)methyl]benzoic acid (CAS 428498-47-9) is a chemical compound with the molecular formula C16H13IO5 and a molecular weight of 412.17 g/mol. IUPAC name: 4-[(4-formyl-2-iodo-6-methoxyphenoxy)methyl]benzoic acid. InChIKey: NWNJHZSTJXLLBV-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13IO5
Molecular weight412.17 g/mol
IUPAC name4-[(4-formyl-2-iodo-6-methoxyphenoxy)methyl]benzoic acid
InChIKeyNWNJHZSTJXLLBV-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)C=O)I)OCC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)