CAS 428512-45-2 is the registry number for Benzyl (2S,3R)-3-isopropylaziridine-2-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S,3R)-3-propan-2-ylaziridine-2-carboxylate (CAS 428512-45-2) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: benzyl (2S,3R)-3-propan-2-ylaziridine-2-carboxylate. InChIKey: JUDZFAQSAHVUOK-NEPJUHHUSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | benzyl (2S,3R)-3-propan-2-ylaziridine-2-carboxylate |
| InChIKey | JUDZFAQSAHVUOK-NEPJUHHUSA-N |
| SMILES | CC(C)[C@@H]1[C@H](N1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)