CAS 42860-37-7 is the registry number for 2,3,4,5-Tetrachlorobenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3,4,5-tetrachlorobenzamide (CAS 42860-37-7) is a chemical compound with the molecular formula C7H3Cl4NO and a molecular weight of 258.9 g/mol. IUPAC name: 2,3,4,5-tetrachlorobenzamide. InChIKey: SGKGFWQVQOSXQR-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl4NO |
|---|---|
| Molecular weight | 258.9 g/mol |
| IUPAC name | 2,3,4,5-tetrachlorobenzamide |
| InChIKey | SGKGFWQVQOSXQR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)