CAS 42872-29-7 appears in our catalog under these names: Ketoprofen Impurity 42, Ketoprofen Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1-cyanoethyl)benzoyl chloride (CAS 42872-29-7) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 3-(1-cyanoethyl)benzoyl chloride. InChIKey: XXQNFMGCPMJJSJ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 3-(1-cyanoethyl)benzoyl chloride |
| InChIKey | XXQNFMGCPMJJSJ-UHFFFAOYSA-N |
| SMILES | CC(C#N)C1=CC(=CC=C1)C(=O)Cl |
Computed by PubChem (NCBI)