CAS 428820-82-0 is the registry number for Benzoic acid, 3-borono-5-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1-methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[3-methoxycarbonyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 428820-82-0) is a chemical compound with the molecular formula C13H18BNO6 and a molecular weight of 295.10 g/mol. IUPAC name: [3-methoxycarbonyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: PLVWSJLJTXOVHI-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO6 |
|---|---|
| Molecular weight | 295.10 g/mol |
| IUPAC name | [3-methoxycarbonyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | PLVWSJLJTXOVHI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)NC(=O)OC(C)(C)C)C(=O)OC)(O)O |
Computed by PubChem (NCBI)