CAS 428820-95-5 appears in our catalog under these names: 3,5-Dinitrophenylboronic acid, pinacol ester, 95%, 95%, 3,5-Dinitrophenylboronic acid, pinacol ester, 95%, 2-(3,5-Dinitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%, 2-(3,5-Dinitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98+%, 3,5–Dinitrophenylboronic Acid Pinacol Ester. Offered by: Chemat, Combi-blocks, Ambeed, GLPBio, TCI. Available pack sizes: 100mg, 250mg, 1g, 5g, 200mg.
2-(3,5-dinitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 428820-95-5) is a chemical compound with the molecular formula C12H15BN2O6 and a molecular weight of 294.07 g/mol. IUPAC name: 2-(3,5-dinitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SFFDLKOCTJMCCJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O6 |
|---|---|
| Molecular weight | 294.07 g/mol |
| IUPAC name | 2-(3,5-dinitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SFFDLKOCTJMCCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)