CAS 428820-97-7 appears in our catalog under these names: (2-((1,3-Dioxoisoindolin-2-yl)methyl)phenyl)boronic acid, 95%, 95%, (2-((1,3-Dioxoisoindolin-2-yl)methyl)phenyl)boronic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
[2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]boronic acid (CAS 428820-97-7) is a chemical compound with the molecular formula C15H12BNO4 and a molecular weight of 281.07 g/mol. IUPAC name: [2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]boronic acid. InChIKey: HJPCDDJFZRITLG-UHFFFAOYSA-N.
| Molecular formula | C15H12BNO4 |
|---|---|
| Molecular weight | 281.07 g/mol |
| IUPAC name | [2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]boronic acid |
| InChIKey | HJPCDDJFZRITLG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CN2C(=O)C3=CC=CC=C3C2=O)(O)O |
Computed by PubChem (NCBI)