CAS 428868-32-0 appears in our catalog under these names: 1,2,3,4,8,9,10,10a-Octahydro-7bh-cyclopenta(B)(1,4)diazepino(6,7,1hj)indole, WAY 163909. Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, 25 mg, 50 mg, 5 mg, 10 mg, 100 mg.
(11R,15R)-7,10-diazatetracyclo[8.5.1.05,16.011,15]hexadeca-1,3,5(16)-triene (CAS 428868-32-0) is a chemical compound with the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. IUPAC name: (11R,15R)-7,10-diazatetracyclo[8.5.1.05,16.011,15]hexadeca-1,3,5(16)-triene. InChIKey: XOSKJKGKWRIMGV-DGCLKSJQSA-N.
| Molecular formula | C14H18N2 |
|---|---|
| Molecular weight | 214.31 g/mol |
| IUPAC name | (11R,15R)-7,10-diazatetracyclo[8.5.1.05,16.011,15]hexadeca-1,3,5(16)-triene |
| InChIKey | XOSKJKGKWRIMGV-DGCLKSJQSA-N |
| SMILES | C1C[C@H]2[C@@H](C1)N3CCNCC4=C3C2=CC=C4 |
Computed by PubChem (NCBI)