CAS 428871-73-2 is the registry number for 4-Amino-2-fluoro-5-nitrobenzotrifluoride. Offered by: Biosynth. Available pack sizes: 2,5g.
5-fluoro-2-nitro-4-(trifluoromethyl)aniline (CAS 428871-73-2) is a chemical compound with the molecular formula C7H4F4N2O2 and a molecular weight of 224.11 g/mol. IUPAC name: 5-fluoro-2-nitro-4-(trifluoromethyl)aniline. InChIKey: UTRVMCDXCUQEEJ-UHFFFAOYSA-N.
| Molecular formula | C7H4F4N2O2 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 5-fluoro-2-nitro-4-(trifluoromethyl)aniline |
| InChIKey | UTRVMCDXCUQEEJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])N)F)C(F)(F)F |
Computed by PubChem (NCBI)