CAS 42932-61-6 appears in our catalog under these names: delta-Valerolactone-3,3,4,4-d4, 98 atom % D, min 98% Chemical Purity, Tetrahydro-2H-pyran-2-one-d4, 98.6%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 50 mg, 25 mg, 5 mg, 10 mg.
4,4,5,5-tetradeuteriooxan-2-one (CAS 42932-61-6) is a chemical compound with the molecular formula C5H8O2 and a molecular weight of 104.14 g/mol. IUPAC name: 4,4,5,5-tetradeuteriooxan-2-one. InChIKey: OZJPLYNZGCXSJM-LNLMKGTHSA-N.
| Molecular formula | C5H8O2 |
|---|---|
| Molecular weight | 104.14 g/mol |
| IUPAC name | 4,4,5,5-tetradeuteriooxan-2-one |
| InChIKey | OZJPLYNZGCXSJM-LNLMKGTHSA-N |
| SMILES | [2H]C1(CC(=O)OCC1([2H])[2H])[2H] |
Computed by PubChem (NCBI)