Products 42950-74-3
CAS 42950-74-3 appears in our catalog under these names: 2-Phenyl-d5-ethan-1,1,2,2-d4-ol, 98 atom % D, min 98% Chemical Purity, 2-Phenylethanol-d9. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1,1,2,2-tetradeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanol (CAS 42950-74-3) is a chemical compound with the molecular formula C8H10O and a molecular weight of 131.22 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanol. InChIKey: WRMNZCZEMHIOCP-NVLGFDPUSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 131.22 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanol |
| InChIKey | WRMNZCZEMHIOCP-NVLGFDPUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])O)[2H])[2H] |
Computed by PubChem (NCBI)