CAS 429673-81-4 appears in our catalog under these names: 1-Pyrrolidinecarboxylic acid, 3-hydroxy-4-(methylamino)-, 1,1-dimethylethyl ester, (3s,4s)-, 95%, tert-Butyl trans-3-Hydroxy-4-(methylamino)pyrrolidine-1-carboxylate. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 2,5g.
Tert-butyl (3S,4S)-3-hydroxy-4-(methylamino)pyrrolidine-1-carboxylate (CAS 429673-81-4) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3S,4S)-3-hydroxy-4-(methylamino)pyrrolidine-1-carboxylate. InChIKey: IJLLHXGWHBTSPV-YUMQZZPRSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-hydroxy-4-(methylamino)pyrrolidine-1-carboxylate |
| InChIKey | IJLLHXGWHBTSPV-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)O)NC |
Computed by PubChem (NCBI)