Products 4297-20-5

CAS 4297-20-5 is the registry number for Rel-(3R)-L-valinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R,3S)-3-amino-2-methylbutanoic acid (CAS 4297-20-5) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. IUPAC name: (2R,3S)-3-amino-2-methylbutanoic acid. InChIKey: RRWPLOJQTOADRZ-DMTCNVIQSA-N.

Identity
Molecular formulaC5H11NO2
Molecular weight117.15 g/mol
IUPAC name(2R,3S)-3-amino-2-methylbutanoic acid
InChIKeyRRWPLOJQTOADRZ-DMTCNVIQSA-N
SMILESC[C@H]([C@H](C)N)C(=O)O

Computed by PubChem (NCBI)