CAS 42971-12-0 appears in our catalog under these names: Vinpocetine Impurity F, Vinpocetine Impurity 6, (3R,16R)-Vinpocetine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl (15R,19R)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene-17-carboxylate (CAS 42971-12-0) is a chemical compound with the molecular formula C22H26N2O2 and a molecular weight of 350.5 g/mol. IUPAC name: ethyl (15R,19R)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene-17-carboxylate. InChIKey: DDNCQMVWWZOMLN-RBBKRZOGSA-N.
| Molecular formula | C22H26N2O2 |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | ethyl (15R,19R)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene-17-carboxylate |
| InChIKey | DDNCQMVWWZOMLN-RBBKRZOGSA-N |
| SMILES | CC[C@]12CCCN3[C@H]1C4=C(CC3)C5=CC=CC=C5N4C(=C2)C(=O)OCC |
Computed by PubChem (NCBI)