CAS 42982-87-6 appears in our catalog under these names: Quinidine methiodide, Quinidine methiodide, Quinidine methiodide, 99.75%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 100mg, 1g, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg.
(S)-[(1S,2R,4S,5R)-5-ethenyl-1-methyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol iodide (CAS 42982-87-6) is a chemical compound with the molecular formula C21H27IN2O2 and a molecular weight of 466.4 g/mol. IUPAC name: (S)-[(1S,2R,4S,5R)-5-ethenyl-1-methyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol iodide. InChIKey: AJQSDVGBERUTGX-WJPDFMMVSA-M.
| Molecular formula | C21H27IN2O2 |
|---|---|
| Molecular weight | 466.4 g/mol |
| IUPAC name | (S)-[(1S,2R,4S,5R)-5-ethenyl-1-methyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol iodide |
| InChIKey | AJQSDVGBERUTGX-WJPDFMMVSA-M |
| SMILES | C[N@@+]12CC[C@@H](C[C@@H]1[C@H](C3=C4C=C(C=CC4=NC=C3)OC)O)[C@H](C2)C=C.[I-] |
Computed by PubChem (NCBI)