CAS 4299-32-5 is the registry number for Calcium Levofolinate Impurity 9. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoic acid (CAS 4299-32-5) is a chemical compound with the molecular formula C14H16N6O3 and a molecular weight of 316.32 g/mol. IUPAC name: 4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoic acid. InChIKey: OXIZGFYJYJOABB-UHFFFAOYSA-N.
| Molecular formula | C14H16N6O3 |
|---|---|
| Molecular weight | 316.32 g/mol |
| IUPAC name | 4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoic acid |
| InChIKey | OXIZGFYJYJOABB-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C(N1)N=C(NC2=O)N)CNC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)