CAS 4299-69-8 appears in our catalog under these names: (S)-Benzyl 2-amino-3-(1H-indol-3-yl)propanoate, 97%, L–Tryptophan benzyl ester, L-Tryptophan benzyl ester, H-Trp-OBzl 95%, L-Tryptophan Benzyl Ester, 97%, 97%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg, 1000mg, 2000mg, 25g.
Benzyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate (CAS 4299-69-8) is a chemical compound with the molecular formula C18H18N2O2 and a molecular weight of 294.3 g/mol. IUPAC name: benzyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate. InChIKey: TYQYRKDGHAPZRF-INIZCTEOSA-N.
| Molecular formula | C18H18N2O2 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
| InChIKey | TYQYRKDGHAPZRF-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CC2=CNC3=CC=CC=C32)N |
Computed by PubChem (NCBI)