CAS 43023-95-6 is the registry number for Rubidium hexafluoroarsenate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g.
Hexafluoroarsenic(1-);rubidium(1+) (CAS 43023-95-6) is a chemical compound with the molecular formula AsF6Rb and a molecular weight of 274.380 g/mol. IUPAC name: hexafluoroarsenic(1-);rubidium(1+). InChIKey: FDUSNUSHTOTAKN-UHFFFAOYSA-N.
| Molecular formula | AsF6Rb |
|---|---|
| Molecular weight | 274.380 g/mol |
| IUPAC name | hexafluoroarsenic(1-);rubidium(1+) |
| InChIKey | FDUSNUSHTOTAKN-UHFFFAOYSA-N |
| SMILES | F[As-](F)(F)(F)(F)F.[Rb+] |
Computed by PubChem (NCBI)