CAS 4303-59-7 is the registry number for 2–METHYLALLYL TRIPHENYLPHOSPHONIUM CHLORIDE. Offered by: GLPBio. Available pack sizes: 250mg.
2-methylprop-2-enyl(triphenyl)phosphanium chloride (CAS 4303-59-7) is a chemical compound with the molecular formula C22H22ClP and a molecular weight of 352.8 g/mol. IUPAC name: 2-methylprop-2-enyl(triphenyl)phosphanium chloride. InChIKey: JDFGGWZVSCEWOJ-UHFFFAOYSA-M.
| Molecular formula | C22H22ClP |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | 2-methylprop-2-enyl(triphenyl)phosphanium chloride |
| InChIKey | JDFGGWZVSCEWOJ-UHFFFAOYSA-M |
| SMILES | CC(=C)C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-] |
Computed by PubChem (NCBI)