CAS 431-91-4 is the registry number for 1,1,1-Tribromotrifluoroacetone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,1,1-tribromo-3,3,3-trifluoropropan-2-one (CAS 431-91-4) is a chemical compound with the molecular formula C3Br3F3O and a molecular weight of 348.74 g/mol. IUPAC name: 1,1,1-tribromo-3,3,3-trifluoropropan-2-one. InChIKey: JKQXEWCRXCUQNU-UHFFFAOYSA-N.
| Molecular formula | C3Br3F3O |
|---|---|
| Molecular weight | 348.74 g/mol |
| IUPAC name | 1,1,1-tribromo-3,3,3-trifluoropropan-2-one |
| InChIKey | JKQXEWCRXCUQNU-UHFFFAOYSA-N |
| SMILES | C(=O)(C(F)(F)F)C(Br)(Br)Br |
Computed by PubChem (NCBI)