Products 43110-92-5
CAS 43110-92-5 is the registry number for Indolylmethyl-desulfoglucosinolate. Offered by: MedChemExpress. Available pack sizes: Get quote.
Indolylmethyl desulfoglucosinolate is a desulfoglucosinolic acid resulting from the formal condensation of the thiol group of N-hydroxy(indol-3-yl)ethanethioamide with beta-D-glucopyranose.
Source: ChEBI
| Molecular formula | C16H20N2O6S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N-hydroxy-2-(1H-indol-3-yl)ethanimidothioate |
| InChIKey | CWNIQCOMWQROPA-JZYAIQKZSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=NO)S[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Computed by PubChem (NCBI)