CAS 43197-33-7 appears in our catalog under these names: Carbidopa EP Impurity J (2-Bromo Carbidopa), (S)-3-(2-Bromo-4,5-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid, 98%, Carbidopa Impurity 10(Carbidopa EP Impurity J), 2-Bromo (S)-Carbidopa, >95% (HPLC), 2-Bromo (S)-carbidopa. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(2S)-3-(2-bromo-4,5-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid (CAS 43197-33-7) is a chemical compound with the molecular formula C10H13BrN2O4 and a molecular weight of 305.12 g/mol. IUPAC name: (2S)-3-(2-bromo-4,5-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid. InChIKey: ZIBONFZRHFUWIX-JTQLQIEISA-N.
| Molecular formula | C10H13BrN2O4 |
|---|---|
| Molecular weight | 305.12 g/mol |
| IUPAC name | (2S)-3-(2-bromo-4,5-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
| InChIKey | ZIBONFZRHFUWIX-JTQLQIEISA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1Br)O)O)(C(=O)O)NN |
Computed by PubChem (NCBI)