Products 4320-13-2
CAS 4320-13-2 appears in our catalog under these names: Thiazinamium chloride (Multergan chloride), Thiazinamium (chloride), 97.44%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, Get quote.
Trimethyl(1-phenothiazin-10-ylpropan-2-yl)azanium chloride (CAS 4320-13-2) is a chemical compound with the molecular formula C18H23ClN2S and a molecular weight of 334.9 g/mol. IUPAC name: trimethyl(1-phenothiazin-10-ylpropan-2-yl)azanium chloride. InChIKey: NGYRQLDJZVHTFE-UHFFFAOYSA-M.
| Molecular formula | C18H23ClN2S |
|---|---|
| Molecular weight | 334.9 g/mol |
| IUPAC name | trimethyl(1-phenothiazin-10-ylpropan-2-yl)azanium chloride |
| InChIKey | NGYRQLDJZVHTFE-UHFFFAOYSA-M |
| SMILES | CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
THIAZINAMIUM CHLORIDE, Thiazinamium chloride [USAN], trimethyl(1-phenothiazin-10-ylpropan-2-yl)azanium;chloride, Thiazinamium chloride (USAN), Trimethyl(1-methyl-2-phenothiazin-10-ylethyl)-ammonium chloride, N,N,N-Trimethyl-1-(10H-phenothiazin-10-yl)propan-2-aminium chloride, orb1708368, 10H-Phenothiazine-10-ethanaminium, N,N,N,alpha-tetramethyl-, chloride