CAS 43200-88-0 appears in our catalog under these names: Zopiclone Impurity 25, Zopiclone Impurity 27, 6-(5-Chloropyrid-2-yl)-7-phenoxycarbonyloxy-6,7-dihydropyrrolo(3,4-b)pyrazin-5-one. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] phenyl carbonate (CAS 43200-88-0) is a chemical compound with the molecular formula C18H11ClN4O4 and a molecular weight of 382.8 g/mol. IUPAC name: [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] phenyl carbonate. InChIKey: NCGZEYCAQLHEII-UHFFFAOYSA-N.
| Molecular formula | C18H11ClN4O4 |
|---|---|
| Molecular weight | 382.8 g/mol |
| IUPAC name | [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] phenyl carbonate |
| InChIKey | NCGZEYCAQLHEII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)OC2C3=NC=CN=C3C(=O)N2C4=NC=C(C=C4)Cl |
Computed by PubChem (NCBI)