CAS 432028-10-9 is the registry number for 3,5-Bis(pentafluorothio)bromobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[3-bromo-5-(pentafluoro-lambda6-sulfanyl)phenyl]-pentafluoro-lambda6-sulfane (CAS 432028-10-9) is a chemical compound with the molecular formula C6H3BrF10S2 and a molecular weight of 409.1 g/mol. IUPAC name: [3-bromo-5-(pentafluoro-lambda6-sulfanyl)phenyl]-pentafluoro-lambda6-sulfane. InChIKey: DGYQEZASMTZUGL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF10S2 |
|---|---|
| Molecular weight | 409.1 g/mol |
| IUPAC name | [3-bromo-5-(pentafluoro-lambda6-sulfanyl)phenyl]-pentafluoro-lambda6-sulfane |
| InChIKey | DGYQEZASMTZUGL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(F)(F)(F)(F)F)Br)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)