CAS 4322-58-1 appears in our catalog under these names: 3,3'–((2–Chlorophenyl)methylene)bis(4–hydroxy–2H–chromen–2–one), 3,3'-((2-Chlorophenyl)methylene)bis(4-hydroxy-2H-chromen-2-one), Urease-IN-17. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 10 mg, 5 mg, 1 mg, 25 mg.
3-[(2-chlorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one (CAS 4322-58-1) is a chemical compound with the molecular formula C25H15ClO6 and a molecular weight of 446.8 g/mol. IUPAC name: 3-[(2-chlorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one. InChIKey: XJJPVDONOLMSOS-UHFFFAOYSA-N.
| Molecular formula | C25H15ClO6 |
|---|---|
| Molecular weight | 446.8 g/mol |
| IUPAC name | 3-[(2-chlorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
| InChIKey | XJJPVDONOLMSOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)O2)C(C3=CC=CC=C3Cl)C4=C(C5=CC=CC=C5OC4=O)O)O |
Computed by PubChem (NCBI)