CAS 4329-78-6 appears in our catalog under these names: Xanthine oxidoreductase-IN-6, 99.33%, Topiroxostat Impurity 8, Topiroxostat Impurity 16, 4,4'–(1H–1,2,4–Triazole–3,5–diyl)dipyridine, 3,5-dipyridyl-1,2,4-triazole 97%. Offered by: MedChemExpress, Chemat Brand, GLPBio, Ambeed, Chemat. Available pack sizes: 500 mg, 1 g, 5 g, 250 mg, on request, 1g, 250mg, 5g.
4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyridine (CAS 4329-78-6) is a chemical compound with the molecular formula C12H9N5 and a molecular weight of 223.23 g/mol. IUPAC name: 4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyridine. InChIKey: QUKGHTHKDNHSOX-UHFFFAOYSA-N.
| Molecular formula | C12H9N5 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyridine |
| InChIKey | QUKGHTHKDNHSOX-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC(=NN2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)