CAS 433231-08-4 is the registry number for Mono(3,3'-methylenebis(1-methyl-1H-imidazol-3-ium)) mono(hexafluorophosphate(V)), 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-methyl-3-[(3-methylimidazol-3-ium-1-yl)methyl]imidazol-1-ium dihexafluorophosphate (CAS 433231-08-4) is a chemical compound with the molecular formula C9H14F12N4P2 and a molecular weight of 468.16 g/mol. IUPAC name: 1-methyl-3-[(3-methylimidazol-3-ium-1-yl)methyl]imidazol-1-ium dihexafluorophosphate. InChIKey: HJTDMUCHZMFYMA-UHFFFAOYSA-N.
| Molecular formula | C9H14F12N4P2 |
|---|---|
| Molecular weight | 468.16 g/mol |
| IUPAC name | 1-methyl-3-[(3-methylimidazol-3-ium-1-yl)methyl]imidazol-1-ium dihexafluorophosphate |
| InChIKey | HJTDMUCHZMFYMA-UHFFFAOYSA-N |
| SMILES | C[N+]1=CN(C=C1)CN2C=C[N+](=C2)C.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)