CAS 433248-87-4 appears in our catalog under these names: Dehydro-ZINC39395747, 98%, Dehydro–ZINC39395747, Dehydro-ZINC39395747, 99.20%, 99.20%, Dehydro-ZINC39395747, 98.07%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 1mg, 5 mg, 100 mg.
6-(1,3-benzoxazol-2-ylsulfanylmethyl)-2-sulfanylidene-1H-pyrimidin-4-one (CAS 433248-87-4) is a chemical compound with the molecular formula C12H9N3O2S2 and a molecular weight of 291.4 g/mol. IUPAC name: 6-(1,3-benzoxazol-2-ylsulfanylmethyl)-2-sulfanylidene-1H-pyrimidin-4-one. InChIKey: ZBZUSIRGXUAECB-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2S2 |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | 6-(1,3-benzoxazol-2-ylsulfanylmethyl)-2-sulfanylidene-1H-pyrimidin-4-one |
| InChIKey | ZBZUSIRGXUAECB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)SCC3=CC(=O)NC(=S)N3 |
Computed by PubChem (NCBI)