Products 433313-64-5
CAS 433313-64-5 is the registry number for FKBP51-Hsp90-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N'-bis(3-carbamoyl-4,5-dimethylthiophen-2-yl)pentanediamide (CAS 433313-64-5) is a chemical compound with the molecular formula C19H24N4O4S2 and a molecular weight of 436.6 g/mol. IUPAC name: N,N'-bis(3-carbamoyl-4,5-dimethylthiophen-2-yl)pentanediamide. InChIKey: VDNAKRUIARBLPX-UHFFFAOYSA-N.
| Molecular formula | C19H24N4O4S2 |
|---|---|
| Molecular weight | 436.6 g/mol |
| IUPAC name | N,N'-bis(3-carbamoyl-4,5-dimethylthiophen-2-yl)pentanediamide |
| InChIKey | VDNAKRUIARBLPX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)N)NC(=O)CCCC(=O)NC2=C(C(=C(S2)C)C)C(=O)N)C |
Computed by PubChem (NCBI)